C16H20N2OS2 — CID 7614087
(2R)-2-(4H-3,1-benzothiazin-2-ylsulfanyl)-N-cyclopentylpropanamide (PubChem CID 7614087) has the molecular formula C16H20N2OS2 and a molecular weight of 320.48 g/mol. Its IUPAC name is (2R)-2-(4H-3,1-benzothiazin-2-ylsulfanyl)-N-cyclopentylpropanamide.
| Compound Name | (2R)-2-(4H-3,1-benzothiazin-2-ylsulfanyl)-N-cyclopentylpropanamide |
|---|---|
| PubChem CID | 7614087 |
| Molecular Formula | C16H20N2OS2 |
| Molecular Weight | 320.48 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | (2R)-2-(4H-3,1-benzothiazin-2-ylsulfanyl)-N-cyclopentylpropanamide |
| SMILES | C[C@@H](SC1=Nc2ccccc2CS1)C(=O)NC1CCCC1 |
| InChI | InChI=1S/C16H20N2OS2/c1-11(15(19)17-13-7-3-4-8-13)21-16-18-14-9-5-2-6-12(14)10-20-16/h2,5-6,9,11,13H,3-4,7-8,10H2,1H3,(H,17,19)/t11-/m1/s1 |
| InChIKey | JPGCWJFWERDYAF-LLVKDONJSA-N |
| XLogP | 4.10 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.48 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |