C18H24N2OS2 — CID 7633885
(2R)-2-(4H-3,1-benzothiazin-2-ylsulfanyl)-N-(cyclohexylmethyl)propanamide (PubChem CID 7633885) has the molecular formula C18H24N2OS2 and a molecular weight of 348.54 g/mol. Its IUPAC name is (2R)-2-(4H-3,1-benzothiazin-2-ylsulfanyl)-N-(cyclohexylmethyl)propanamide.
| Compound Name | (2R)-2-(4H-3,1-benzothiazin-2-ylsulfanyl)-N-(cyclohexylmethyl)propanamide |
|---|---|
| PubChem CID | 7633885 |
| Molecular Formula | C18H24N2OS2 |
| Molecular Weight | 348.54 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | (2R)-2-(4H-3,1-benzothiazin-2-ylsulfanyl)-N-(cyclohexylmethyl)propanamide |
| SMILES | C[C@@H](SC1=Nc2ccccc2CS1)C(=O)NCC1CCCCC1 |
| InChI | InChI=1S/C18H24N2OS2/c1-13(17(21)19-11-14-7-3-2-4-8-14)23-18-20-16-10-6-5-9-15(16)12-22-18/h5-6,9-10,13-14H,2-4,7-8,11-12H2,1H3,(H,19,21)/t13-/m1/s1 |
| InChIKey | NALOPNUQKOOCCO-CYBMUJFWSA-N |
| XLogP | 4.74 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.54 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |