C17H22N2OS2 — CID 7633482
2-(4H-3,1-benzothiazin-2-ylsulfanyl)-N-cycloheptylacetamide (PubChem CID 7633482) has the molecular formula C17H22N2OS2 and a molecular weight of 334.51 g/mol. Its IUPAC name is 2-(4H-3,1-benzothiazin-2-ylsulfanyl)-N-cycloheptylacetamide.
| Compound Name | 2-(4H-3,1-benzothiazin-2-ylsulfanyl)-N-cycloheptylacetamide |
|---|---|
| PubChem CID | 7633482 |
| Molecular Formula | C17H22N2OS2 |
| Molecular Weight | 334.51 g/mol |
| Exact Mass | 334.12 |
| IUPAC Name | 2-(4H-3,1-benzothiazin-2-ylsulfanyl)-N-cycloheptylacetamide |
| SMILES | O=C(CSC1=Nc2ccccc2CS1)NC1CCCCCC1 |
| InChI | InChI=1S/C17H22N2OS2/c20-16(18-14-8-3-1-2-4-9-14)12-22-17-19-15-10-6-5-7-13(15)11-21-17/h5-7,10,14H,1-4,8-9,11-12H2,(H,18,20) |
| InChIKey | CARVZWUVTJZOKO-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.51 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |