C25H27FN2O5S — CID 46628965
3-[5-(2-fluorophenyl)furan-2-yl]-N-(2-methoxy-5-piperidin-1-ylsulfonylphenyl)propanamide (PubChem CID 46628965) has the molecular formula C25H27FN2O5S and a molecular weight of 486.57 g/mol. Its IUPAC name is 3-[5-(2-fluorophenyl)furan-2-yl]-N-(2-methoxy-5-piperidin-1-ylsulfonylphenyl)propanamide.
| Compound Name | 3-[5-(2-fluorophenyl)furan-2-yl]-N-(2-methoxy-5-piperidin-1-ylsulfonylphenyl)propanamide |
|---|---|
| PubChem CID | 46628965 |
| Molecular Formula | C25H27FN2O5S |
| Molecular Weight | 486.57 g/mol |
| Exact Mass | 486.16 |
| IUPAC Name | 3-[5-(2-fluorophenyl)furan-2-yl]-N-(2-methoxy-5-piperidin-1-ylsulfonylphenyl)propanamide |
| SMILES | COc1ccc(S(=O)(=O)N2CCCCC2)cc1NC(=O)CCc1ccc(-c2ccccc2F)o1 |
| InChI | InChI=1S/C25H27FN2O5S/c1-32-24-13-11-19(34(30,31)28-15-5-2-6-16-28)17-22(24)27-25(29)14-10-18-9-12-23(33-18)20-7-3-4-8-21(20)26/h3-4,7-9,11-13,17H,2,5-6,10,14-16H2,1H3,(H,27,29) |
| InChIKey | NRNKTNYXYNEKMI-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.57 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |