C20H23F2N3O6 — CID 46632237
2-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl-methylamino]-N-(4-methoxy-2-nitrophenyl)propanamide (PubChem CID 46632237) has the molecular formula C20H23F2N3O6 and a molecular weight of 439.42 g/mol. Its IUPAC name is 2-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl-methylamino]-N-(4-methoxy-2-nitrophenyl)propanamide.
| Compound Name | 2-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl-methylamino]-N-(4-methoxy-2-nitrophenyl)propanamide |
|---|---|
| PubChem CID | 46632237 |
| Molecular Formula | C20H23F2N3O6 |
| Molecular Weight | 439.42 g/mol |
| Exact Mass | 439.16 |
| IUPAC Name | 2-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl-methylamino]-N-(4-methoxy-2-nitrophenyl)propanamide |
| SMILES | COc1ccc(NC(=O)C(C)N(C)Cc2ccc(OC(F)F)c(OC)c2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H23F2N3O6/c1-12(19(26)23-15-7-6-14(29-3)10-16(15)25(27)28)24(2)11-13-5-8-17(31-20(21)22)18(9-13)30-4/h5-10,12,20H,11H2,1-4H3,(H,23,26) |
| InChIKey | GIBGRHARTFLKNC-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 103.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.42 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|