C18H16F2N2O7 — CID 8540067
[(2S)-1-(4-methoxy-2-nitroanilino)-1-oxopropan-2-yl] 2-(difluoromethoxy)benzoate (PubChem CID 8540067) has the molecular formula C18H16F2N2O7 and a molecular weight of 410.33 g/mol. Its IUPAC name is [(2S)-1-(4-methoxy-2-nitroanilino)-1-oxopropan-2-yl] 2-(difluoromethoxy)benzoate.
| Compound Name | [(2S)-1-(4-methoxy-2-nitroanilino)-1-oxopropan-2-yl] 2-(difluoromethoxy)benzoate |
|---|---|
| PubChem CID | 8540067 |
| Molecular Formula | C18H16F2N2O7 |
| Molecular Weight | 410.33 g/mol |
| Exact Mass | 410.09 |
| IUPAC Name | [(2S)-1-(4-methoxy-2-nitroanilino)-1-oxopropan-2-yl] 2-(difluoromethoxy)benzoate |
| SMILES | COc1ccc(NC(=O)[C@H](C)OC(=O)c2ccccc2OC(F)F)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H16F2N2O7/c1-10(28-17(24)12-5-3-4-6-15(12)29-18(19)20)16(23)21-13-8-7-11(27-2)9-14(13)22(25)26/h3-10,18H,1-2H3,(H,21,23)/t10-/m0/s1 |
| InChIKey | FPTCKOODSBWEKF-JTQLQIEISA-N |
| XLogP | 3.39 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.33 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|