C20H17N3O6 — CID 9061839
[(2S)-1-(4-methoxy-2-nitroanilino)-1-oxopropan-2-yl] quinoline-8-carboxylate (PubChem CID 9061839) has the molecular formula C20H17N3O6 and a molecular weight of 395.37 g/mol. Its IUPAC name is [(2S)-1-(4-methoxy-2-nitroanilino)-1-oxopropan-2-yl] quinoline-8-carboxylate.
| Compound Name | [(2S)-1-(4-methoxy-2-nitroanilino)-1-oxopropan-2-yl] quinoline-8-carboxylate |
|---|---|
| PubChem CID | 9061839 |
| Molecular Formula | C20H17N3O6 |
| Molecular Weight | 395.37 g/mol |
| Exact Mass | 395.11 |
| IUPAC Name | [(2S)-1-(4-methoxy-2-nitroanilino)-1-oxopropan-2-yl] quinoline-8-carboxylate |
| SMILES | COc1ccc(NC(=O)[C@H](C)OC(=O)c2cccc3cccnc23)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H17N3O6/c1-12(19(24)22-16-9-8-14(28-2)11-17(16)23(26)27)29-20(25)15-7-3-5-13-6-4-10-21-18(13)15/h3-12H,1-2H3,(H,22,24)/t12-/m0/s1 |
| InChIKey | VJGSOAAXTZTVBS-LBPRGKRZSA-N |
| XLogP | 3.34 |
| TPSA | 120.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.37 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|