C15H13BrN2O6S — CID 46621235
[1-(4-methoxy-2-nitroanilino)-1-oxopropan-2-yl] 5-bromothiophene-2-carboxylate (PubChem CID 46621235) has the molecular formula C15H13BrN2O6S and a molecular weight of 429.25 g/mol. Its IUPAC name is [1-(4-methoxy-2-nitroanilino)-1-oxopropan-2-yl] 5-bromothiophene-2-carboxylate.
| Compound Name | [1-(4-methoxy-2-nitroanilino)-1-oxopropan-2-yl] 5-bromothiophene-2-carboxylate |
|---|---|
| PubChem CID | 46621235 |
| Molecular Formula | C15H13BrN2O6S |
| Molecular Weight | 429.25 g/mol |
| Exact Mass | 427.97 |
| IUPAC Name | [1-(4-methoxy-2-nitroanilino)-1-oxopropan-2-yl] 5-bromothiophene-2-carboxylate |
| SMILES | COc1ccc(NC(=O)C(C)OC(=O)c2ccc(Br)s2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H13BrN2O6S/c1-8(24-15(20)12-5-6-13(16)25-12)14(19)17-10-4-3-9(23-2)7-11(10)18(21)22/h3-8H,1-2H3,(H,17,19) |
| InChIKey | HSBCISZJKOYBHJ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.25 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|