C24H23FN2O4 — CID 46632974
4-(4-fluorophenoxy)-N'-[2-(2-phenylphenoxy)acetyl]butanehydrazide (PubChem CID 46632974) has the molecular formula C24H23FN2O4 and a molecular weight of 422.46 g/mol. Its IUPAC name is 4-(4-fluorophenoxy)-N'-[2-(2-phenylphenoxy)acetyl]butanehydrazide.
| Compound Name | 4-(4-fluorophenoxy)-N'-[2-(2-phenylphenoxy)acetyl]butanehydrazide |
|---|---|
| PubChem CID | 46632974 |
| Molecular Formula | C24H23FN2O4 |
| Molecular Weight | 422.46 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | 4-(4-fluorophenoxy)-N'-[2-(2-phenylphenoxy)acetyl]butanehydrazide |
| SMILES | O=C(CCCOc1ccc(F)cc1)NNC(=O)COc1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C24H23FN2O4/c25-19-12-14-20(15-13-19)30-16-6-11-23(28)26-27-24(29)17-31-22-10-5-4-9-21(22)18-7-2-1-3-8-18/h1-5,7-10,12-15H,6,11,16-17H2,(H,26,28)(H,27,29) |
| InChIKey | OTWYSZKRNCIQFC-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.46 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|