C18H16BrN5O4 — CID 46634586
N-(4-bromo-2-methylphenyl)-2-[methyl-(3-nitro-4-oxopyrido[1,2-a]pyrimidin-2-yl)amino]acetamide (PubChem CID 46634586) has the molecular formula C18H16BrN5O4 and a molecular weight of 446.26 g/mol. Its IUPAC name is N-(4-bromo-2-methylphenyl)-2-[methyl-(3-nitro-4-oxopyrido[1,2-a]pyrimidin-2-yl)amino]acetamide.
| Compound Name | N-(4-bromo-2-methylphenyl)-2-[methyl-(3-nitro-4-oxopyrido[1,2-a]pyrimidin-2-yl)amino]acetamide |
|---|---|
| PubChem CID | 46634586 |
| Molecular Formula | C18H16BrN5O4 |
| Molecular Weight | 446.26 g/mol |
| Exact Mass | 445.04 |
| IUPAC Name | N-(4-bromo-2-methylphenyl)-2-[methyl-(3-nitro-4-oxopyrido[1,2-a]pyrimidin-2-yl)amino]acetamide |
| SMILES | Cc1cc(Br)ccc1NC(=O)CN(C)c1nc2ccccn2c(=O)c1[N+](=O)[O-] |
| InChI | InChI=1S/C18H16BrN5O4/c1-11-9-12(19)6-7-13(11)20-15(25)10-22(2)17-16(24(27)28)18(26)23-8-4-3-5-14(23)21-17/h3-9H,10H2,1-2H3,(H,20,25) |
| InChIKey | PKDPCZYJDXQNEL-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.26 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|