C10H7Cl2NO2 — CID 4663588
[5-(3,4-dichlorophenyl)-1,2-oxazol-3-yl]methanol (PubChem CID 4663588) has the molecular formula C10H7Cl2NO2 and a molecular weight of 244.08 g/mol. Its IUPAC name is [5-(3,4-dichlorophenyl)-1,2-oxazol-3-yl]methanol.
| Compound Name | [5-(3,4-dichlorophenyl)-1,2-oxazol-3-yl]methanol |
|---|---|
| PubChem CID | 4663588 |
| Molecular Formula | C10H7Cl2NO2 |
| Molecular Weight | 244.08 g/mol |
| Exact Mass | 242.99 |
| IUPAC Name | [5-(3,4-dichlorophenyl)-1,2-oxazol-3-yl]methanol |
| SMILES | OCc1cc(-c2ccc(Cl)c(Cl)c2)on1 |
| InChI | InChI=1S/C10H7Cl2NO2/c11-8-2-1-6(3-9(8)12)10-4-7(5-14)13-15-10/h1-4,14H,5H2 |
| InChIKey | XDHFBKUYZJPSFQ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.08 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |