C14H14INO5S — CID 46640502
[2-(3-iodoanilino)-2-oxoethyl] 2-(1,1-dioxo-2,3-dihydrothiophen-3-yl)acetate (PubChem CID 46640502) has the molecular formula C14H14INO5S and a molecular weight of 435.24 g/mol. Its IUPAC name is [2-(3-iodoanilino)-2-oxoethyl] 2-(1,1-dioxo-2,3-dihydrothiophen-3-yl)acetate.
| Compound Name | [2-(3-iodoanilino)-2-oxoethyl] 2-(1,1-dioxo-2,3-dihydrothiophen-3-yl)acetate |
|---|---|
| PubChem CID | 46640502 |
| Molecular Formula | C14H14INO5S |
| Molecular Weight | 435.24 g/mol |
| Exact Mass | 434.96 |
| IUPAC Name | [2-(3-iodoanilino)-2-oxoethyl] 2-(1,1-dioxo-2,3-dihydrothiophen-3-yl)acetate |
| SMILES | O=C(COC(=O)CC1C=CS(=O)(=O)C1)Nc1cccc(I)c1 |
| InChI | InChI=1S/C14H14INO5S/c15-11-2-1-3-12(7-11)16-13(17)8-21-14(18)6-10-4-5-22(19,20)9-10/h1-5,7,10H,6,8-9H2,(H,16,17) |
| InChIKey | WZVIGDQGOVUGMH-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.24 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|