C25H28N2O4S — CID 4664363
2-[N-(benzenesulfonyl)-3,4-dimethylanilino]-N-(2-phenylmethoxyethyl)acetamide (PubChem CID 4664363) has the molecular formula C25H28N2O4S and a molecular weight of 452.58 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-3,4-dimethylanilino]-N-(2-phenylmethoxyethyl)acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-3,4-dimethylanilino]-N-(2-phenylmethoxyethyl)acetamide |
|---|---|
| PubChem CID | 4664363 |
| Molecular Formula | C25H28N2O4S |
| Molecular Weight | 452.58 g/mol |
| Exact Mass | 452.18 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-3,4-dimethylanilino]-N-(2-phenylmethoxyethyl)acetamide |
| SMILES | Cc1ccc(N(CC(=O)NCCOCc2ccccc2)S(=O)(=O)c2ccccc2)cc1C |
| InChI | InChI=1S/C25H28N2O4S/c1-20-13-14-23(17-21(20)2)27(32(29,30)24-11-7-4-8-12-24)18-25(28)26-15-16-31-19-22-9-5-3-6-10-22/h3-14,17H,15-16,18-19H2,1-2H3,(H,26,28) |
| InChIKey | JVYAVPKKFTZPBK-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.58 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|