C17H17NO5S — CID 46644115
[2-methoxy-4-[(E)-prop-1-enyl]phenyl] 4-carbamoylbenzenesulfonate (PubChem CID 46644115) has the molecular formula C17H17NO5S and a molecular weight of 347.39 g/mol. Its IUPAC name is [2-methoxy-4-[(E)-prop-1-enyl]phenyl] 4-carbamoylbenzenesulfonate.
| Compound Name | [2-methoxy-4-[(E)-prop-1-enyl]phenyl] 4-carbamoylbenzenesulfonate |
|---|---|
| PubChem CID | 46644115 |
| Molecular Formula | C17H17NO5S |
| Molecular Weight | 347.39 g/mol |
| Exact Mass | 347.08 |
| IUPAC Name | [2-methoxy-4-[(E)-prop-1-enyl]phenyl] 4-carbamoylbenzenesulfonate |
| SMILES | C/C=C/c1ccc(OS(=O)(=O)c2ccc(C(N)=O)cc2)c(OC)c1 |
| InChI | InChI=1S/C17H17NO5S/c1-3-4-12-5-10-15(16(11-12)22-2)23-24(20,21)14-8-6-13(7-9-14)17(18)19/h3-11H,1-2H3,(H2,18,19)/b4-3+ |
| InChIKey | XINGXTXMYKYRFV-ONEGZZNKSA-N |
| XLogP | 2.59 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.39 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|