C20H25NO6S2 — CID 32940454
[2-methoxy-4-[(E)-prop-1-enyl]phenyl] 4-(diethylsulfamoyl)benzenesulfonate (PubChem CID 32940454) has the molecular formula C20H25NO6S2 and a molecular weight of 439.56 g/mol. Its IUPAC name is [2-methoxy-4-[(E)-prop-1-enyl]phenyl] 4-(diethylsulfamoyl)benzenesulfonate.
| Compound Name | [2-methoxy-4-[(E)-prop-1-enyl]phenyl] 4-(diethylsulfamoyl)benzenesulfonate |
|---|---|
| PubChem CID | 32940454 |
| Molecular Formula | C20H25NO6S2 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.11 |
| IUPAC Name | [2-methoxy-4-[(E)-prop-1-enyl]phenyl] 4-(diethylsulfamoyl)benzenesulfonate |
| SMILES | C/C=C/c1ccc(OS(=O)(=O)c2ccc(S(=O)(=O)N(CC)CC)cc2)c(OC)c1 |
| InChI | InChI=1S/C20H25NO6S2/c1-5-8-16-9-14-19(20(15-16)26-4)27-29(24,25)18-12-10-17(11-13-18)28(22,23)21(6-2)7-3/h5,8-15H,6-7H2,1-4H3/b8-5+ |
| InChIKey | OHESZEHSJNDZGV-VMPITWQZSA-N |
| XLogP | 3.53 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|