C22H25F3N2O5S — CID 46644366
4-methoxy-3-[(2-methylcyclohexyl)sulfamoyl]-N-[2-(trifluoromethoxy)phenyl]benzamide (PubChem CID 46644366) has the molecular formula C22H25F3N2O5S and a molecular weight of 486.51 g/mol. Its IUPAC name is 4-methoxy-3-[(2-methylcyclohexyl)sulfamoyl]-N-[2-(trifluoromethoxy)phenyl]benzamide.
| Compound Name | 4-methoxy-3-[(2-methylcyclohexyl)sulfamoyl]-N-[2-(trifluoromethoxy)phenyl]benzamide |
|---|---|
| PubChem CID | 46644366 |
| Molecular Formula | C22H25F3N2O5S |
| Molecular Weight | 486.51 g/mol |
| Exact Mass | 486.14 |
| IUPAC Name | 4-methoxy-3-[(2-methylcyclohexyl)sulfamoyl]-N-[2-(trifluoromethoxy)phenyl]benzamide |
| SMILES | COc1ccc(C(=O)Nc2ccccc2OC(F)(F)F)cc1S(=O)(=O)NC1CCCCC1C |
| InChI | InChI=1S/C22H25F3N2O5S/c1-14-7-3-4-8-16(14)27-33(29,30)20-13-15(11-12-19(20)31-2)21(28)26-17-9-5-6-10-18(17)32-22(23,24)25/h5-6,9-14,16,27H,3-4,7-8H2,1-2H3,(H,26,28) |
| InChIKey | LUIPPSIGBOZBFV-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.51 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |