C21H21N5O5S2 — CID 46645045
[2-(6-nitro-3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl] 2-[(4-ethyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]acetate (PubChem CID 46645045) has the molecular formula C21H21N5O5S2 and a molecular weight of 487.56 g/mol. Its IUPAC name is [2-(6-nitro-3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl] 2-[(4-ethyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]acetate.
| Compound Name | [2-(6-nitro-3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl] 2-[(4-ethyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]acetate |
|---|---|
| PubChem CID | 46645045 |
| Molecular Formula | C21H21N5O5S2 |
| Molecular Weight | 487.56 g/mol |
| Exact Mass | 487.10 |
| IUPAC Name | [2-(6-nitro-3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl] 2-[(4-ethyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]acetate |
| SMILES | CCn1c(SCC(=O)OCC(=O)N2CCCc3cc([N+](=O)[O-])ccc32)nnc1-c1cccs1 |
| InChI | InChI=1S/C21H21N5O5S2/c1-2-24-20(17-6-4-10-32-17)22-23-21(24)33-13-19(28)31-12-18(27)25-9-3-5-14-11-15(26(29)30)7-8-16(14)25/h4,6-8,10-11H,2-3,5,9,12-13H2,1H3 |
| InChIKey | DJDCRFGIVGPONV-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 120.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.56 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|