C20H24N4O5 — CID 46646435
3-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-(2-methyl-3-oxo-4H-1,4-benzoxazin-6-yl)propanamide (PubChem CID 46646435) has the molecular formula C20H24N4O5 and a molecular weight of 400.44 g/mol. Its IUPAC name is 3-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-(2-methyl-3-oxo-4H-1,4-benzoxazin-6-yl)propanamide.
| Compound Name | 3-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-(2-methyl-3-oxo-4H-1,4-benzoxazin-6-yl)propanamide |
|---|---|
| PubChem CID | 46646435 |
| Molecular Formula | C20H24N4O5 |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | 3-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-(2-methyl-3-oxo-4H-1,4-benzoxazin-6-yl)propanamide |
| SMILES | CC1Oc2ccc(NC(=O)CCN3C(=O)NC4(CCCCC4)C3=O)cc2NC1=O |
| InChI | InChI=1S/C20H24N4O5/c1-12-17(26)22-14-11-13(5-6-15(14)29-12)21-16(25)7-10-24-18(27)20(23-19(24)28)8-3-2-4-9-20/h5-6,11-12H,2-4,7-10H2,1H3,(H,21,25)(H,22,26)(H,23,28) |
| InChIKey | PNWUOBYSIOKLAD-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|