C23H21ClN4O6 — CID 46650152
[1-(4-methoxy-2-nitroanilino)-1-oxopropan-2-yl] (E)-3-(5-chloro-3-methyl-1-phenylpyrazol-4-yl)prop-2-enoate (PubChem CID 46650152) has the molecular formula C23H21ClN4O6 and a molecular weight of 484.90 g/mol. Its IUPAC name is [1-(4-methoxy-2-nitroanilino)-1-oxopropan-2-yl] (E)-3-(5-chloro-3-methyl-1-phenylpyrazol-4-yl)prop-2-enoate.
| Compound Name | [1-(4-methoxy-2-nitroanilino)-1-oxopropan-2-yl] (E)-3-(5-chloro-3-methyl-1-phenylpyrazol-4-yl)prop-2-enoate |
|---|---|
| PubChem CID | 46650152 |
| Molecular Formula | C23H21ClN4O6 |
| Molecular Weight | 484.90 g/mol |
| Exact Mass | 484.11 |
| IUPAC Name | [1-(4-methoxy-2-nitroanilino)-1-oxopropan-2-yl] (E)-3-(5-chloro-3-methyl-1-phenylpyrazol-4-yl)prop-2-enoate |
| SMILES | COc1ccc(NC(=O)C(C)OC(=O)/C=C/c2c(C)nn(-c3ccccc3)c2Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H21ClN4O6/c1-14-18(22(24)27(26-14)16-7-5-4-6-8-16)10-12-21(29)34-15(2)23(30)25-19-11-9-17(33-3)13-20(19)28(31)32/h4-13,15H,1-3H3,(H,25,30)/b12-10+ |
| InChIKey | DSDSUBGTARAUQA-ZRDIBKRKSA-N |
| XLogP | 4.33 |
| TPSA | 125.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.90 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|