C25H22N4O6 — CID 46654586
3-(3,4-dimethoxyphenyl)-N-[(2-hydroxy-5-nitrophenyl)methyl]-1-phenylpyrazole-4-carboxamide (PubChem CID 46654586) has the molecular formula C25H22N4O6 and a molecular weight of 474.47 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-N-[(2-hydroxy-5-nitrophenyl)methyl]-1-phenylpyrazole-4-carboxamide.
| Compound Name | 3-(3,4-dimethoxyphenyl)-N-[(2-hydroxy-5-nitrophenyl)methyl]-1-phenylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 46654586 |
| Molecular Formula | C25H22N4O6 |
| Molecular Weight | 474.47 g/mol |
| Exact Mass | 474.15 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)-N-[(2-hydroxy-5-nitrophenyl)methyl]-1-phenylpyrazole-4-carboxamide |
| SMILES | COc1ccc(-c2nn(-c3ccccc3)cc2C(=O)NCc2cc([N+](=O)[O-])ccc2O)cc1OC |
| InChI | InChI=1S/C25H22N4O6/c1-34-22-11-8-16(13-23(22)35-2)24-20(15-28(27-24)18-6-4-3-5-7-18)25(31)26-14-17-12-19(29(32)33)9-10-21(17)30/h3-13,15,30H,14H2,1-2H3,(H,26,31) |
| InChIKey | HDWVLKZZSDNABU-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 128.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.47 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|