C23H27N3OS2 — CID 46662340
2-(1,3-benzothiazol-2-ylmethylsulfanyl)-N-methyl-N-[(4-piperidin-1-ylphenyl)methyl]acetamide (PubChem CID 46662340) has the molecular formula C23H27N3OS2 and a molecular weight of 425.62 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-ylmethylsulfanyl)-N-methyl-N-[(4-piperidin-1-ylphenyl)methyl]acetamide.
| Compound Name | 2-(1,3-benzothiazol-2-ylmethylsulfanyl)-N-methyl-N-[(4-piperidin-1-ylphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 46662340 |
| Molecular Formula | C23H27N3OS2 |
| Molecular Weight | 425.62 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | 2-(1,3-benzothiazol-2-ylmethylsulfanyl)-N-methyl-N-[(4-piperidin-1-ylphenyl)methyl]acetamide |
| SMILES | CN(Cc1ccc(N2CCCCC2)cc1)C(=O)CSCc1nc2ccccc2s1 |
| InChI | InChI=1S/C23H27N3OS2/c1-25(15-18-9-11-19(12-10-18)26-13-5-2-6-14-26)23(27)17-28-16-22-24-20-7-3-4-8-21(20)29-22/h3-4,7-12H,2,5-6,13-17H2,1H3 |
| InChIKey | YUTLTVOFXIJLRC-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.62 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|