C22H19BrN4O5S — CID 4666294
N-[1-(3-bromophenyl)ethylideneamino]-2-(N-(2-nitrophenyl)sulfonylanilino)acetamide (PubChem CID 4666294) has the molecular formula C22H19BrN4O5S and a molecular weight of 531.39 g/mol. Its IUPAC name is N-[1-(3-bromophenyl)ethylideneamino]-2-(N-(2-nitrophenyl)sulfonylanilino)acetamide.
| Compound Name | N-[1-(3-bromophenyl)ethylideneamino]-2-(N-(2-nitrophenyl)sulfonylanilino)acetamide |
|---|---|
| PubChem CID | 4666294 |
| Molecular Formula | C22H19BrN4O5S |
| Molecular Weight | 531.39 g/mol |
| Exact Mass | 530.03 |
| IUPAC Name | N-[1-(3-bromophenyl)ethylideneamino]-2-(N-(2-nitrophenyl)sulfonylanilino)acetamide |
| SMILES | CC(=NNC(=O)CN(c1ccccc1)S(=O)(=O)c1ccccc1[N+](=O)[O-])c1cccc(Br)c1 |
| InChI | InChI=1S/C22H19BrN4O5S/c1-16(17-8-7-9-18(23)14-17)24-25-22(28)15-26(19-10-3-2-4-11-19)33(31,32)21-13-6-5-12-20(21)27(29)30/h2-14H,15H2,1H3,(H,25,28) |
| InChIKey | PTLFVBIJJKUSFZ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 121.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.39 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|