C21H23ClN4O2 — CID 46664447
N-[2-(2-chlorophenyl)-2-(dimethylamino)ethyl]-2-(8-methyl-4-oxoquinazolin-3-yl)acetamide (PubChem CID 46664447) has the molecular formula C21H23ClN4O2 and a molecular weight of 398.89 g/mol. Its IUPAC name is N-[2-(2-chlorophenyl)-2-(dimethylamino)ethyl]-2-(8-methyl-4-oxoquinazolin-3-yl)acetamide.
| Compound Name | N-[2-(2-chlorophenyl)-2-(dimethylamino)ethyl]-2-(8-methyl-4-oxoquinazolin-3-yl)acetamide |
|---|---|
| PubChem CID | 46664447 |
| Molecular Formula | C21H23ClN4O2 |
| Molecular Weight | 398.89 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | N-[2-(2-chlorophenyl)-2-(dimethylamino)ethyl]-2-(8-methyl-4-oxoquinazolin-3-yl)acetamide |
| SMILES | Cc1cccc2c(=O)n(CC(=O)NCC(c3ccccc3Cl)N(C)C)cnc12 |
| InChI | InChI=1S/C21H23ClN4O2/c1-14-7-6-9-16-20(14)24-13-26(21(16)28)12-19(27)23-11-18(25(2)3)15-8-4-5-10-17(15)22/h4-10,13,18H,11-12H2,1-3H3,(H,23,27) |
| InChIKey | FWGWLDGCACDVRI-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.89 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |