C19H19ClN2O2 — CID 4666541
2-[(2-chlorophenyl)methylideneamino]oxy-N-(1,2,3,4-tetrahydronaphthalen-1-yl)acetamide (PubChem CID 4666541) has the molecular formula C19H19ClN2O2 and a molecular weight of 342.83 g/mol. Its IUPAC name is 2-[(2-chlorophenyl)methylideneamino]oxy-N-(1,2,3,4-tetrahydronaphthalen-1-yl)acetamide.
| Compound Name | 2-[(2-chlorophenyl)methylideneamino]oxy-N-(1,2,3,4-tetrahydronaphthalen-1-yl)acetamide |
|---|---|
| PubChem CID | 4666541 |
| Molecular Formula | C19H19ClN2O2 |
| Molecular Weight | 342.83 g/mol |
| Exact Mass | 342.11 |
| IUPAC Name | 2-[(2-chlorophenyl)methylideneamino]oxy-N-(1,2,3,4-tetrahydronaphthalen-1-yl)acetamide |
| SMILES | O=C(CON=Cc1ccccc1Cl)NC1CCCc2ccccc21 |
| InChI | InChI=1S/C19H19ClN2O2/c20-17-10-4-2-7-15(17)12-21-24-13-19(23)22-18-11-5-8-14-6-1-3-9-16(14)18/h1-4,6-7,9-10,12,18H,5,8,11,13H2,(H,22,23) |
| InChIKey | YIWCTVDIDUKWRT-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.83 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|