C25H22ClNO — CID 94011690
(E)-3-(2-chlorophenyl)-2-phenyl-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]prop-2-enamide (PubChem CID 94011690) has the molecular formula C25H22ClNO and a molecular weight of 387.91 g/mol. Its IUPAC name is (E)-3-(2-chlorophenyl)-2-phenyl-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]prop-2-enamide.
| Compound Name | (E)-3-(2-chlorophenyl)-2-phenyl-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]prop-2-enamide |
|---|---|
| PubChem CID | 94011690 |
| Molecular Formula | C25H22ClNO |
| Molecular Weight | 387.91 g/mol |
| Exact Mass | 387.14 |
| IUPAC Name | (E)-3-(2-chlorophenyl)-2-phenyl-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]prop-2-enamide |
| SMILES | O=C(N[C@@H]1CCCc2ccccc21)/C(=C/c1ccccc1Cl)c1ccccc1 |
| InChI | InChI=1S/C25H22ClNO/c26-23-15-7-5-12-20(23)17-22(19-9-2-1-3-10-19)25(28)27-24-16-8-13-18-11-4-6-14-21(18)24/h1-7,9-12,14-15,17,24H,8,13,16H2,(H,27,28)/b22-17+/t24-/m1/s1 |
| InChIKey | UJMHPIQLWXCKOH-CAZPATRMSA-N |
| XLogP | 6.07 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.91 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|