C18H19N3O2 — CID 47023890
1-benzamido-3-(1,2,3,4-tetrahydronaphthalen-1-yl)urea (PubChem CID 47023890) has the molecular formula C18H19N3O2 and a molecular weight of 309.37 g/mol. Its IUPAC name is 1-benzamido-3-(1,2,3,4-tetrahydronaphthalen-1-yl)urea.
| Compound Name | 1-benzamido-3-(1,2,3,4-tetrahydronaphthalen-1-yl)urea |
|---|---|
| PubChem CID | 47023890 |
| Molecular Formula | C18H19N3O2 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | 1-benzamido-3-(1,2,3,4-tetrahydronaphthalen-1-yl)urea |
| SMILES | O=C(NNC(=O)c1ccccc1)NC1CCCc2ccccc21 |
| InChI | InChI=1S/C18H19N3O2/c22-17(14-8-2-1-3-9-14)20-21-18(23)19-16-12-6-10-13-7-4-5-11-15(13)16/h1-5,7-9,11,16H,6,10,12H2,(H,20,22)(H2,19,21,23) |
| InChIKey | VDKNCJHGAPTJFD-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|