C17H18BrClN2O2 — CID 46666741
4-[2-(2-bromo-4-chlorophenoxy)ethylamino]-N,N-dimethylbenzamide (PubChem CID 46666741) has the molecular formula C17H18BrClN2O2 and a molecular weight of 397.70 g/mol. Its IUPAC name is 4-[2-(2-bromo-4-chlorophenoxy)ethylamino]-N,N-dimethylbenzamide.
| Compound Name | 4-[2-(2-bromo-4-chlorophenoxy)ethylamino]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 46666741 |
| Molecular Formula | C17H18BrClN2O2 |
| Molecular Weight | 397.70 g/mol |
| Exact Mass | 396.02 |
| IUPAC Name | 4-[2-(2-bromo-4-chlorophenoxy)ethylamino]-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1ccc(NCCOc2ccc(Cl)cc2Br)cc1 |
| InChI | InChI=1S/C17H18BrClN2O2/c1-21(2)17(22)12-3-6-14(7-4-12)20-9-10-23-16-8-5-13(19)11-15(16)18/h3-8,11,20H,9-10H2,1-2H3 |
| InChIKey | BBCUIMNQORVXTK-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.70 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|