C19H17N3O3S — CID 46672415
methyl 2-[methyl-(2-quinazolin-4-ylsulfanylacetyl)amino]benzoate (PubChem CID 46672415) has the molecular formula C19H17N3O3S and a molecular weight of 367.43 g/mol. Its IUPAC name is methyl 2-[methyl-(2-quinazolin-4-ylsulfanylacetyl)amino]benzoate.
| Compound Name | methyl 2-[methyl-(2-quinazolin-4-ylsulfanylacetyl)amino]benzoate |
|---|---|
| PubChem CID | 46672415 |
| Molecular Formula | C19H17N3O3S |
| Molecular Weight | 367.43 g/mol |
| Exact Mass | 367.10 |
| IUPAC Name | methyl 2-[methyl-(2-quinazolin-4-ylsulfanylacetyl)amino]benzoate |
| SMILES | COC(=O)c1ccccc1N(C)C(=O)CSc1ncnc2ccccc12 |
| InChI | InChI=1S/C19H17N3O3S/c1-22(16-10-6-4-8-14(16)19(24)25-2)17(23)11-26-18-13-7-3-5-9-15(13)20-12-21-18/h3-10,12H,11H2,1-2H3 |
| InChIKey | CCZIJLVQDFBLPH-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 72.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.43 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |