C22H23N3O3S — CID 46667992
methyl 2-[[2-[(4-benzyl-5-methyl-1H-imidazol-2-yl)sulfanyl]acetyl]-methylamino]benzoate (PubChem CID 46667992) has the molecular formula C22H23N3O3S and a molecular weight of 409.51 g/mol. Its IUPAC name is methyl 2-[[2-[(4-benzyl-5-methyl-1H-imidazol-2-yl)sulfanyl]acetyl]-methylamino]benzoate.
| Compound Name | methyl 2-[[2-[(4-benzyl-5-methyl-1H-imidazol-2-yl)sulfanyl]acetyl]-methylamino]benzoate |
|---|---|
| PubChem CID | 46667992 |
| Molecular Formula | C22H23N3O3S |
| Molecular Weight | 409.51 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | methyl 2-[[2-[(4-benzyl-5-methyl-1H-imidazol-2-yl)sulfanyl]acetyl]-methylamino]benzoate |
| SMILES | COC(=O)c1ccccc1N(C)C(=O)CSc1nc(Cc2ccccc2)c(C)[nH]1 |
| InChI | InChI=1S/C22H23N3O3S/c1-15-18(13-16-9-5-4-6-10-16)24-22(23-15)29-14-20(26)25(2)19-12-8-7-11-17(19)21(27)28-3/h4-12H,13-14H2,1-3H3,(H,23,24) |
| InChIKey | ZPJPKJWTUSINOX-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 75.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.51 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |