C17H24ClN3O2S — CID 46672821
2-[5-chloro-1-(2-methoxyethyl)benzimidazol-2-yl]sulfanyl-N-pentan-2-ylacetamide (PubChem CID 46672821) has the molecular formula C17H24ClN3O2S and a molecular weight of 369.92 g/mol. Its IUPAC name is 2-[5-chloro-1-(2-methoxyethyl)benzimidazol-2-yl]sulfanyl-N-pentan-2-ylacetamide.
| Compound Name | 2-[5-chloro-1-(2-methoxyethyl)benzimidazol-2-yl]sulfanyl-N-pentan-2-ylacetamide |
|---|---|
| PubChem CID | 46672821 |
| Molecular Formula | C17H24ClN3O2S |
| Molecular Weight | 369.92 g/mol |
| Exact Mass | 369.13 |
| IUPAC Name | 2-[5-chloro-1-(2-methoxyethyl)benzimidazol-2-yl]sulfanyl-N-pentan-2-ylacetamide |
| SMILES | CCCC(C)NC(=O)CSc1nc2cc(Cl)ccc2n1CCOC |
| InChI | InChI=1S/C17H24ClN3O2S/c1-4-5-12(2)19-16(22)11-24-17-20-14-10-13(18)6-7-15(14)21(17)8-9-23-3/h6-7,10,12H,4-5,8-9,11H2,1-3H3,(H,19,22) |
| InChIKey | FVZJLDCKNCQSIA-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.92 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |