C18H18BrN5OS — CID 46673009
2-(1-benzyltetrazol-5-yl)sulfanyl-N-[1-(4-bromophenyl)ethyl]acetamide (PubChem CID 46673009) has the molecular formula C18H18BrN5OS and a molecular weight of 432.35 g/mol. Its IUPAC name is 2-(1-benzyltetrazol-5-yl)sulfanyl-N-[1-(4-bromophenyl)ethyl]acetamide.
| Compound Name | 2-(1-benzyltetrazol-5-yl)sulfanyl-N-[1-(4-bromophenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 46673009 |
| Molecular Formula | C18H18BrN5OS |
| Molecular Weight | 432.35 g/mol |
| Exact Mass | 431.04 |
| IUPAC Name | 2-(1-benzyltetrazol-5-yl)sulfanyl-N-[1-(4-bromophenyl)ethyl]acetamide |
| SMILES | CC(NC(=O)CSc1nnnn1Cc1ccccc1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C18H18BrN5OS/c1-13(15-7-9-16(19)10-8-15)20-17(25)12-26-18-21-22-23-24(18)11-14-5-3-2-4-6-14/h2-10,13H,11-12H2,1H3,(H,20,25) |
| InChIKey | KLRPWLLAOGQBFM-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.35 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |