C15H19FN4O — CID 46673146
N-(2-cyanoethyl)-2-[4-(4-fluorophenyl)piperazin-1-yl]acetamide (PubChem CID 46673146) has the molecular formula C15H19FN4O and a molecular weight of 290.34 g/mol. Its IUPAC name is N-(2-cyanoethyl)-2-[4-(4-fluorophenyl)piperazin-1-yl]acetamide.
| Compound Name | N-(2-cyanoethyl)-2-[4-(4-fluorophenyl)piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 46673146 |
| Molecular Formula | C15H19FN4O |
| Molecular Weight | 290.34 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | N-(2-cyanoethyl)-2-[4-(4-fluorophenyl)piperazin-1-yl]acetamide |
| SMILES | N#CCCNC(=O)CN1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C15H19FN4O/c16-13-2-4-14(5-3-13)20-10-8-19(9-11-20)12-15(21)18-7-1-6-17/h2-5H,1,7-12H2,(H,18,21) |
| InChIKey | YVKJMWSCNFCDHM-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 59.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.34 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|