C20H21FN4OS — CID 8703950
N-[2-(cyanomethylsulfanyl)phenyl]-2-[4-(4-fluorophenyl)piperazin-1-yl]acetamide (PubChem CID 8703950) has the molecular formula C20H21FN4OS and a molecular weight of 384.48 g/mol. Its IUPAC name is N-[2-(cyanomethylsulfanyl)phenyl]-2-[4-(4-fluorophenyl)piperazin-1-yl]acetamide.
| Compound Name | N-[2-(cyanomethylsulfanyl)phenyl]-2-[4-(4-fluorophenyl)piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 8703950 |
| Molecular Formula | C20H21FN4OS |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | N-[2-(cyanomethylsulfanyl)phenyl]-2-[4-(4-fluorophenyl)piperazin-1-yl]acetamide |
| SMILES | N#CCSc1ccccc1NC(=O)CN1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C20H21FN4OS/c21-16-5-7-17(8-6-16)25-12-10-24(11-13-25)15-20(26)23-18-3-1-2-4-19(18)27-14-9-22/h1-8H,10-15H2,(H,23,26) |
| InChIKey | VHPZLEYECAVNDH-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 59.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |