C19H20F3N3O3S — CID 55464521
N-[2-(difluoromethylsulfonyl)phenyl]-2-[4-(4-fluorophenyl)piperazin-1-yl]acetamide (PubChem CID 55464521) has the molecular formula C19H20F3N3O3S and a molecular weight of 427.45 g/mol. Its IUPAC name is N-[2-(difluoromethylsulfonyl)phenyl]-2-[4-(4-fluorophenyl)piperazin-1-yl]acetamide.
| Compound Name | N-[2-(difluoromethylsulfonyl)phenyl]-2-[4-(4-fluorophenyl)piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 55464521 |
| Molecular Formula | C19H20F3N3O3S |
| Molecular Weight | 427.45 g/mol |
| Exact Mass | 427.12 |
| IUPAC Name | N-[2-(difluoromethylsulfonyl)phenyl]-2-[4-(4-fluorophenyl)piperazin-1-yl]acetamide |
| SMILES | O=C(CN1CCN(c2ccc(F)cc2)CC1)Nc1ccccc1S(=O)(=O)C(F)F |
| InChI | InChI=1S/C19H20F3N3O3S/c20-14-5-7-15(8-6-14)25-11-9-24(10-12-25)13-18(26)23-16-3-1-2-4-17(16)29(27,28)19(21)22/h1-8,19H,9-13H2,(H,23,26) |
| InChIKey | JPEUHSNEJQKFMX-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.45 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |