C23H26N4O2S — CID 26666155
N-benzyl-1-[2-[2-(cyanomethylsulfanyl)anilino]-2-oxoethyl]piperidine-4-carboxamide (PubChem CID 26666155) has the molecular formula C23H26N4O2S and a molecular weight of 422.55 g/mol. Its IUPAC name is N-benzyl-1-[2-[2-(cyanomethylsulfanyl)anilino]-2-oxoethyl]piperidine-4-carboxamide.
| Compound Name | N-benzyl-1-[2-[2-(cyanomethylsulfanyl)anilino]-2-oxoethyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 26666155 |
| Molecular Formula | C23H26N4O2S |
| Molecular Weight | 422.55 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | N-benzyl-1-[2-[2-(cyanomethylsulfanyl)anilino]-2-oxoethyl]piperidine-4-carboxamide |
| SMILES | N#CCSc1ccccc1NC(=O)CN1CCC(C(=O)NCc2ccccc2)CC1 |
| InChI | InChI=1S/C23H26N4O2S/c24-12-15-30-21-9-5-4-8-20(21)26-22(28)17-27-13-10-19(11-14-27)23(29)25-16-18-6-2-1-3-7-18/h1-9,19H,10-11,13-17H2,(H,25,29)(H,26,28) |
| InChIKey | YDGCIENXLDLPSS-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 85.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.55 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |