C16H15N3OS3 — CID 46678523
N-(6-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)-2-thiophen-2-yl-1,3-thiazole-4-carboxamide (PubChem CID 46678523) has the molecular formula C16H15N3OS3 and a molecular weight of 361.52 g/mol. Its IUPAC name is N-(6-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)-2-thiophen-2-yl-1,3-thiazole-4-carboxamide.
| Compound Name | N-(6-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)-2-thiophen-2-yl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 46678523 |
| Molecular Formula | C16H15N3OS3 |
| Molecular Weight | 361.52 g/mol |
| Exact Mass | 361.04 |
| IUPAC Name | N-(6-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)-2-thiophen-2-yl-1,3-thiazole-4-carboxamide |
| SMILES | CC1CCc2nc(NC(=O)c3csc(-c4cccs4)n3)sc2C1 |
| InChI | InChI=1S/C16H15N3OS3/c1-9-4-5-10-13(7-9)23-16(18-10)19-14(20)11-8-22-15(17-11)12-3-2-6-21-12/h2-3,6,8-9H,4-5,7H2,1H3,(H,18,19,20) |
| InChIKey | PEWBYQSWXNWDNU-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.52 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |