C24H23N3O4S — CID 46679197
N-(2,5-diethoxyphenyl)-2-[2-(furan-2-yl)quinazolin-4-yl]sulfanylacetamide (PubChem CID 46679197) has the molecular formula C24H23N3O4S and a molecular weight of 449.53 g/mol. Its IUPAC name is N-(2,5-diethoxyphenyl)-2-[2-(furan-2-yl)quinazolin-4-yl]sulfanylacetamide.
| Compound Name | N-(2,5-diethoxyphenyl)-2-[2-(furan-2-yl)quinazolin-4-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 46679197 |
| Molecular Formula | C24H23N3O4S |
| Molecular Weight | 449.53 g/mol |
| Exact Mass | 449.14 |
| IUPAC Name | N-(2,5-diethoxyphenyl)-2-[2-(furan-2-yl)quinazolin-4-yl]sulfanylacetamide |
| SMILES | CCOc1ccc(OCC)c(NC(=O)CSc2nc(-c3ccco3)nc3ccccc23)c1 |
| InChI | InChI=1S/C24H23N3O4S/c1-3-29-16-11-12-20(30-4-2)19(14-16)25-22(28)15-32-24-17-8-5-6-9-18(17)26-23(27-24)21-10-7-13-31-21/h5-14H,3-4,15H2,1-2H3,(H,25,28) |
| InChIKey | CVVAEJALJPTNCF-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 86.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.53 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |