C23H18N4O6 — CID 46682163
[1-(4-nitroanilino)-1-oxopropan-2-yl] 3-methyl-6-phenyl-[1,2]oxazolo[5,4-b]pyridine-4-carboxylate (PubChem CID 46682163) has the molecular formula C23H18N4O6 and a molecular weight of 446.42 g/mol. Its IUPAC name is [1-(4-nitroanilino)-1-oxopropan-2-yl] 3-methyl-6-phenyl-[1,2]oxazolo[5,4-b]pyridine-4-carboxylate.
| Compound Name | [1-(4-nitroanilino)-1-oxopropan-2-yl] 3-methyl-6-phenyl-[1,2]oxazolo[5,4-b]pyridine-4-carboxylate |
|---|---|
| PubChem CID | 46682163 |
| Molecular Formula | C23H18N4O6 |
| Molecular Weight | 446.42 g/mol |
| Exact Mass | 446.12 |
| IUPAC Name | [1-(4-nitroanilino)-1-oxopropan-2-yl] 3-methyl-6-phenyl-[1,2]oxazolo[5,4-b]pyridine-4-carboxylate |
| SMILES | Cc1noc2nc(-c3ccccc3)cc(C(=O)OC(C)C(=O)Nc3ccc([N+](=O)[O-])cc3)c12 |
| InChI | InChI=1S/C23H18N4O6/c1-13-20-18(12-19(25-22(20)33-26-13)15-6-4-3-5-7-15)23(29)32-14(2)21(28)24-16-8-10-17(11-9-16)27(30)31/h3-12,14H,1-2H3,(H,24,28) |
| InChIKey | NWICUJGAHQIUHD-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 137.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.42 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|