C24H21N5O5 — CID 46509320
[1-(3-nitroanilino)-1-oxopropan-2-yl] 1,3-dimethyl-6-phenylpyrazolo[5,4-b]pyridine-4-carboxylate (PubChem CID 46509320) has the molecular formula C24H21N5O5 and a molecular weight of 459.46 g/mol. Its IUPAC name is [1-(3-nitroanilino)-1-oxopropan-2-yl] 1,3-dimethyl-6-phenylpyrazolo[5,4-b]pyridine-4-carboxylate.
| Compound Name | [1-(3-nitroanilino)-1-oxopropan-2-yl] 1,3-dimethyl-6-phenylpyrazolo[5,4-b]pyridine-4-carboxylate |
|---|---|
| PubChem CID | 46509320 |
| Molecular Formula | C24H21N5O5 |
| Molecular Weight | 459.46 g/mol |
| Exact Mass | 459.15 |
| IUPAC Name | [1-(3-nitroanilino)-1-oxopropan-2-yl] 1,3-dimethyl-6-phenylpyrazolo[5,4-b]pyridine-4-carboxylate |
| SMILES | Cc1nn(C)c2nc(-c3ccccc3)cc(C(=O)OC(C)C(=O)Nc3cccc([N+](=O)[O-])c3)c12 |
| InChI | InChI=1S/C24H21N5O5/c1-14-21-19(13-20(16-8-5-4-6-9-16)26-22(21)28(3)27-14)24(31)34-15(2)23(30)25-17-10-7-11-18(12-17)29(32)33/h4-13,15H,1-3H3,(H,25,30) |
| InChIKey | DMTTYZZMDLCTFQ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 129.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.46 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|