C22H22N2O3S — CID 46683485
1-[[4-(2-methyl-3,4-dihydro-2H-1,5-benzothiazepine-5-carbonyl)phenyl]methyl]pyrrolidine-2,5-dione (PubChem CID 46683485) has the molecular formula C22H22N2O3S and a molecular weight of 394.50 g/mol. Its IUPAC name is 1-[[4-(2-methyl-3,4-dihydro-2H-1,5-benzothiazepine-5-carbonyl)phenyl]methyl]pyrrolidine-2,5-dione.
| Compound Name | 1-[[4-(2-methyl-3,4-dihydro-2H-1,5-benzothiazepine-5-carbonyl)phenyl]methyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 46683485 |
| Molecular Formula | C22H22N2O3S |
| Molecular Weight | 394.50 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | 1-[[4-(2-methyl-3,4-dihydro-2H-1,5-benzothiazepine-5-carbonyl)phenyl]methyl]pyrrolidine-2,5-dione |
| SMILES | CC1CCN(C(=O)c2ccc(CN3C(=O)CCC3=O)cc2)c2ccccc2S1 |
| InChI | InChI=1S/C22H22N2O3S/c1-15-12-13-23(18-4-2-3-5-19(18)28-15)22(27)17-8-6-16(7-9-17)14-24-20(25)10-11-21(24)26/h2-9,15H,10-14H2,1H3 |
| InChIKey | XHNXRYIIDMTGNI-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.50 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|