C20H23N5OS2 — CID 46683857
N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-3-[(4,5-dicyclopropyl-1,2,4-triazol-3-yl)sulfanyl]propanamide (PubChem CID 46683857) has the molecular formula C20H23N5OS2 and a molecular weight of 413.57 g/mol. Its IUPAC name is N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-3-[(4,5-dicyclopropyl-1,2,4-triazol-3-yl)sulfanyl]propanamide.
| Compound Name | N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-3-[(4,5-dicyclopropyl-1,2,4-triazol-3-yl)sulfanyl]propanamide |
|---|---|
| PubChem CID | 46683857 |
| Molecular Formula | C20H23N5OS2 |
| Molecular Weight | 413.57 g/mol |
| Exact Mass | 413.13 |
| IUPAC Name | N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-3-[(4,5-dicyclopropyl-1,2,4-triazol-3-yl)sulfanyl]propanamide |
| SMILES | N#Cc1c(NC(=O)CCSc2nnc(C3CC3)n2C2CC2)sc2c1CCCC2 |
| InChI | InChI=1S/C20H23N5OS2/c21-11-15-14-3-1-2-4-16(14)28-19(15)22-17(26)9-10-27-20-24-23-18(12-5-6-12)25(20)13-7-8-13/h12-13H,1-10H2,(H,22,26) |
| InChIKey | VZJQMTFBKSCLFV-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 83.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.57 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |