C21H22N6OS2 — CID 46582931
N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-3-[(4-ethyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]propanamide (PubChem CID 46582931) has the molecular formula C21H22N6OS2 and a molecular weight of 438.58 g/mol. Its IUPAC name is N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-3-[(4-ethyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]propanamide.
| Compound Name | N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-3-[(4-ethyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]propanamide |
|---|---|
| PubChem CID | 46582931 |
| Molecular Formula | C21H22N6OS2 |
| Molecular Weight | 438.58 g/mol |
| Exact Mass | 438.13 |
| IUPAC Name | N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-3-[(4-ethyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]propanamide |
| SMILES | CCn1c(SCCC(=O)Nc2sc3c(c2C#N)CCCC3)nnc1-c1ccncc1 |
| InChI | InChI=1S/C21H22N6OS2/c1-2-27-19(14-7-10-23-11-8-14)25-26-21(27)29-12-9-18(28)24-20-16(13-22)15-5-3-4-6-17(15)30-20/h7-8,10-11H,2-6,9,12H2,1H3,(H,24,28) |
| InChIKey | DLZPUUDWJZHOBW-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 96.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.58 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |