C25H28N6O4S3 — CID 3168659
N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-2-[[4-ethyl-5-(4-morpholin-4-ylsulfonylphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 3168659) has the molecular formula C25H28N6O4S3 and a molecular weight of 572.74 g/mol. Its IUPAC name is N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-2-[[4-ethyl-5-(4-morpholin-4-ylsulfonylphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-2-[[4-ethyl-5-(4-morpholin-4-ylsulfonylphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 3168659 |
| Molecular Formula | C25H28N6O4S3 |
| Molecular Weight | 572.74 g/mol |
| Exact Mass | 572.13 |
| IUPAC Name | N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-2-[[4-ethyl-5-(4-morpholin-4-ylsulfonylphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | CCn1c(SCC(=O)Nc2sc3c(c2C#N)CCCC3)nnc1-c1ccc(S(=O)(=O)N2CCOCC2)cc1 |
| InChI | InChI=1S/C25H28N6O4S3/c1-2-31-23(17-7-9-18(10-8-17)38(33,34)30-11-13-35-14-12-30)28-29-25(31)36-16-22(32)27-24-20(15-26)19-5-3-4-6-21(19)37-24/h7-10H,2-6,11-14,16H2,1H3,(H,27,32) |
| InChIKey | PPWFKSAKORVWKH-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 130.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.74 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |