C17H24N6O3 — CID 46688448
N'-(4,6-dimethylpyrimidin-2-yl)-2-(6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetohydrazide (PubChem CID 46688448) has the molecular formula C17H24N6O3 and a molecular weight of 360.42 g/mol. Its IUPAC name is N'-(4,6-dimethylpyrimidin-2-yl)-2-(6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetohydrazide.
| Compound Name | N'-(4,6-dimethylpyrimidin-2-yl)-2-(6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetohydrazide |
|---|---|
| PubChem CID | 46688448 |
| Molecular Formula | C17H24N6O3 |
| Molecular Weight | 360.42 g/mol |
| Exact Mass | 360.19 |
| IUPAC Name | N'-(4,6-dimethylpyrimidin-2-yl)-2-(6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetohydrazide |
| SMILES | Cc1cc(C)nc(NNC(=O)CN2C(=O)NC3(CCCCC3C)C2=O)n1 |
| InChI | InChI=1S/C17H24N6O3/c1-10-6-4-5-7-17(10)14(25)23(16(26)20-17)9-13(24)21-22-15-18-11(2)8-12(3)19-15/h8,10H,4-7,9H2,1-3H3,(H,20,26)(H,21,24)(H,18,19,22) |
| InChIKey | QBKKPLZNVTZRLK-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 116.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.42 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|