C19H24F3N5O2S — CID 46688914
3-[[4-[2-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]methyl]-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepine (PubChem CID 46688914) has the molecular formula C19H24F3N5O2S and a molecular weight of 443.50 g/mol. Its IUPAC name is 3-[[4-[2-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]methyl]-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepine.
| Compound Name | 3-[[4-[2-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]methyl]-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepine |
|---|---|
| PubChem CID | 46688914 |
| Molecular Formula | C19H24F3N5O2S |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.16 |
| IUPAC Name | 3-[[4-[2-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]methyl]-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepine |
| SMILES | O=S(=O)(c1ccccc1C(F)(F)F)N1CCN(Cc2nnc3n2CCCCC3)CC1 |
| InChI | InChI=1S/C19H24F3N5O2S/c20-19(21,22)15-6-3-4-7-16(15)30(28,29)26-12-10-25(11-13-26)14-18-24-23-17-8-2-1-5-9-27(17)18/h3-4,6-7H,1-2,5,8-14H2 |
| InChIKey | KCNQDNAQBVPRPS-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 71.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |