C25H24N6O2S — CID 46690705
N'-[2-(1H-indol-3-yl)acetyl]-6-(5-methylthiophen-2-yl)-1-propan-2-ylpyrazolo[5,4-b]pyridine-4-carbohydrazide (PubChem CID 46690705) has the molecular formula C25H24N6O2S and a molecular weight of 472.57 g/mol. Its IUPAC name is N'-[2-(1H-indol-3-yl)acetyl]-6-(5-methylthiophen-2-yl)-1-propan-2-ylpyrazolo[5,4-b]pyridine-4-carbohydrazide.
| Compound Name | N'-[2-(1H-indol-3-yl)acetyl]-6-(5-methylthiophen-2-yl)-1-propan-2-ylpyrazolo[5,4-b]pyridine-4-carbohydrazide |
|---|---|
| PubChem CID | 46690705 |
| Molecular Formula | C25H24N6O2S |
| Molecular Weight | 472.57 g/mol |
| Exact Mass | 472.17 |
| IUPAC Name | N'-[2-(1H-indol-3-yl)acetyl]-6-(5-methylthiophen-2-yl)-1-propan-2-ylpyrazolo[5,4-b]pyridine-4-carbohydrazide |
| SMILES | Cc1ccc(-c2cc(C(=O)NNC(=O)Cc3c[nH]c4ccccc34)c3cnn(C(C)C)c3n2)s1 |
| InChI | InChI=1S/C25H24N6O2S/c1-14(2)31-24-19(13-27-31)18(11-21(28-24)22-9-8-15(3)34-22)25(33)30-29-23(32)10-16-12-26-20-7-5-4-6-17(16)20/h4-9,11-14,26H,10H2,1-3H3,(H,29,32)(H,30,33) |
| InChIKey | ZBVZIEIQVQCYAX-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 104.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.57 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|