C17H18N4O6 — CID 46696710
[1-(2-nitroanilino)-1-oxopropan-2-yl] 2-oxo-2-(1,3,5-trimethylpyrazol-4-yl)acetate (PubChem CID 46696710) has the molecular formula C17H18N4O6 and a molecular weight of 374.35 g/mol. Its IUPAC name is [1-(2-nitroanilino)-1-oxopropan-2-yl] 2-oxo-2-(1,3,5-trimethylpyrazol-4-yl)acetate.
| Compound Name | [1-(2-nitroanilino)-1-oxopropan-2-yl] 2-oxo-2-(1,3,5-trimethylpyrazol-4-yl)acetate |
|---|---|
| PubChem CID | 46696710 |
| Molecular Formula | C17H18N4O6 |
| Molecular Weight | 374.35 g/mol |
| Exact Mass | 374.12 |
| IUPAC Name | [1-(2-nitroanilino)-1-oxopropan-2-yl] 2-oxo-2-(1,3,5-trimethylpyrazol-4-yl)acetate |
| SMILES | Cc1nn(C)c(C)c1C(=O)C(=O)OC(C)C(=O)Nc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H18N4O6/c1-9-14(10(2)20(4)19-9)15(22)17(24)27-11(3)16(23)18-12-7-5-6-8-13(12)21(25)26/h5-8,11H,1-4H3,(H,18,23) |
| InChIKey | BTFOEANPOOXTRF-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 133.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.35 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|