C23H19N3O3 — CID 46696750
2-oxopropyl 1-benzyl-6-phenylpyrazolo[5,4-b]pyridine-4-carboxylate (PubChem CID 46696750) has the molecular formula C23H19N3O3 and a molecular weight of 385.42 g/mol. Its IUPAC name is 2-oxopropyl 1-benzyl-6-phenylpyrazolo[5,4-b]pyridine-4-carboxylate.
| Compound Name | 2-oxopropyl 1-benzyl-6-phenylpyrazolo[5,4-b]pyridine-4-carboxylate |
|---|---|
| PubChem CID | 46696750 |
| Molecular Formula | C23H19N3O3 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | 2-oxopropyl 1-benzyl-6-phenylpyrazolo[5,4-b]pyridine-4-carboxylate |
| SMILES | CC(=O)COC(=O)c1cc(-c2ccccc2)nc2c1cnn2Cc1ccccc1 |
| InChI | InChI=1S/C23H19N3O3/c1-16(27)15-29-23(28)19-12-21(18-10-6-3-7-11-18)25-22-20(19)13-24-26(22)14-17-8-4-2-5-9-17/h2-13H,14-15H2,1H3 |
| InChIKey | ZXUQFKZXUAJJGX-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 74.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |