C28H19N5O3 — CID 17455590
[4-(1,3,4-oxadiazol-2-yl)phenyl] 1-benzyl-6-phenylpyrazolo[5,4-b]pyridine-4-carboxylate (PubChem CID 17455590) has the molecular formula C28H19N5O3 and a molecular weight of 473.49 g/mol. Its IUPAC name is [4-(1,3,4-oxadiazol-2-yl)phenyl] 1-benzyl-6-phenylpyrazolo[5,4-b]pyridine-4-carboxylate.
| Compound Name | [4-(1,3,4-oxadiazol-2-yl)phenyl] 1-benzyl-6-phenylpyrazolo[5,4-b]pyridine-4-carboxylate |
|---|---|
| PubChem CID | 17455590 |
| Molecular Formula | C28H19N5O3 |
| Molecular Weight | 473.49 g/mol |
| Exact Mass | 473.15 |
| IUPAC Name | [4-(1,3,4-oxadiazol-2-yl)phenyl] 1-benzyl-6-phenylpyrazolo[5,4-b]pyridine-4-carboxylate |
| SMILES | O=C(Oc1ccc(-c2nnco2)cc1)c1cc(-c2ccccc2)nc2c1cnn2Cc1ccccc1 |
| InChI | InChI=1S/C28H19N5O3/c34-28(36-22-13-11-21(12-14-22)27-32-29-18-35-27)23-15-25(20-9-5-2-6-10-20)31-26-24(23)16-30-33(26)17-19-7-3-1-4-8-19/h1-16,18H,17H2 |
| InChIKey | PSVUGWCZWUQVGB-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 95.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.49 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|