C28H22N4O5 — CID 47011339
(2-methoxy-4-methoxycarbonylphenyl) 6-phenyl-1-(pyridin-4-ylmethyl)pyrazolo[5,4-b]pyridine-4-carboxylate (PubChem CID 47011339) has the molecular formula C28H22N4O5 and a molecular weight of 494.51 g/mol. Its IUPAC name is (2-methoxy-4-methoxycarbonylphenyl) 6-phenyl-1-(pyridin-4-ylmethyl)pyrazolo[5,4-b]pyridine-4-carboxylate.
| Compound Name | (2-methoxy-4-methoxycarbonylphenyl) 6-phenyl-1-(pyridin-4-ylmethyl)pyrazolo[5,4-b]pyridine-4-carboxylate |
|---|---|
| PubChem CID | 47011339 |
| Molecular Formula | C28H22N4O5 |
| Molecular Weight | 494.51 g/mol |
| Exact Mass | 494.16 |
| IUPAC Name | (2-methoxy-4-methoxycarbonylphenyl) 6-phenyl-1-(pyridin-4-ylmethyl)pyrazolo[5,4-b]pyridine-4-carboxylate |
| SMILES | COC(=O)c1ccc(OC(=O)c2cc(-c3ccccc3)nc3c2cnn3Cc2ccncc2)c(OC)c1 |
| InChI | InChI=1S/C28H22N4O5/c1-35-25-14-20(27(33)36-2)8-9-24(25)37-28(34)21-15-23(19-6-4-3-5-7-19)31-26-22(21)16-30-32(26)17-18-10-12-29-13-11-18/h3-16H,17H2,1-2H3 |
| InChIKey | UIEANLKSWDJICQ-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 105.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.51 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|